About 2-phenylnonanethial
2-phenylnonanethial (PubChem CID 141351724) has the molecular formula C15H22S
and a molecular weight of 234.41 g/mol. Its IUPAC name is 2-phenylnonanethial.
Molecular Properties
| Compound Name | 2-phenylnonanethial |
| PubChem CID | 141351724 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-phenylnonanethial |
| SMILES | CCCCCCCC(C=S)c1ccccc1 |
| InChI | InChI=1S/C15H22S/c1-2-3-4-5-7-12-15(13-16)14-10-8-6-9-11-14/h6,8-11,13,15H,2-5,7,12H2,1H3 |
| InChIKey | OTTWZJYDIMMZBN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylnonanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylnonanethial?
The IUPAC name of 2-phenylnonanethial (CID 141351724) is 2-phenylnonanethial.
What is the SMILES notation for 2-phenylnonanethial?
The canonical SMILES for 2-phenylnonanethial is CCCCCCCC(C=S)c1ccccc1.
What is the InChIKey of 2-phenylnonanethial?
The InChIKey is OTTWZJYDIMMZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22S/c1-2-3-4-5-7-12-15(13-16)14-10-8-6-9-11-14/h6,8-11,13,15H,2-5,7,12H2,1H3.
What are the key properties of 2-phenylnonanethial?
2-phenylnonanethial has a molecular weight of 234.41 g/mol, XLogP of 5.13, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylnonanethial is sourced from PubChem (CID 141351724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).