About 2-phenyldecanethial
2-phenyldecanethial (PubChem CID 141351719) has the molecular formula C16H24S
and a molecular weight of 248.44 g/mol. Its IUPAC name is 2-phenyldecanethial.
Molecular Properties
| Compound Name | 2-phenyldecanethial |
| PubChem CID | 141351719 |
| Molecular Formula | C16H24S |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-phenyldecanethial |
| SMILES | CCCCCCCCC(C=S)c1ccccc1 |
| InChI | InChI=1S/C16H24S/c1-2-3-4-5-6-8-13-16(14-17)15-11-9-7-10-12-15/h7,9-12,14,16H,2-6,8,13H2,1H3 |
| InChIKey | FYEOAZVDZXUNQB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyldecanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyldecanethial?
The IUPAC name of 2-phenyldecanethial (CID 141351719) is 2-phenyldecanethial.
What is the SMILES notation for 2-phenyldecanethial?
The canonical SMILES for 2-phenyldecanethial is CCCCCCCCC(C=S)c1ccccc1.
What is the InChIKey of 2-phenyldecanethial?
The InChIKey is FYEOAZVDZXUNQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24S/c1-2-3-4-5-6-8-13-16(14-17)15-11-9-7-10-12-15/h7,9-12,14,16H,2-6,8,13H2,1H3.
What are the key properties of 2-phenyldecanethial?
2-phenyldecanethial has a molecular weight of 248.44 g/mol, XLogP of 5.52, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyldecanethial is sourced from PubChem (CID 141351719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).