C13H24O3 — CID 15218281
3,7-dimethyloct-6-enyl ethyl carbonate (PubChem CID 15218281) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enyl ethyl carbonate.
| Compound Name | 3,7-dimethyloct-6-enyl ethyl carbonate |
|---|---|
| PubChem CID | 15218281 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3,7-dimethyloct-6-enyl ethyl carbonate |
| SMILES | CCOC(=O)OCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C13H24O3/c1-5-15-13(14)16-10-9-12(4)8-6-7-11(2)3/h7,12H,5-6,8-10H2,1-4H3 |
| InChIKey | GXKOFANEAPTOJI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|