C13H16N2O — CID 15227846
(Z)-N-hexa-2,5-diynoxy-1-azabicyclo[3.2.1]octan-6-imine (PubChem CID 15227846) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (Z)-N-hexa-2,5-diynoxy-1-azabicyclo[3.2.1]octan-6-imine.
| Compound Name | (Z)-N-hexa-2,5-diynoxy-1-azabicyclo[3.2.1]octan-6-imine |
|---|---|
| PubChem CID | 15227846 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (Z)-N-hexa-2,5-diynoxy-1-azabicyclo[3.2.1]octan-6-imine |
| SMILES | C#CCC#CCO/N=C1\CN2CCCC1C2 |
| InChI | InChI=1S/C13H16N2O/c1-2-3-4-5-9-16-14-13-11-15-8-6-7-12(13)10-15/h1,12H,3,6-11H2/b14-13+ |
| InChIKey | ULKOFEQMOCBCJD-BUHFOSPRSA-N |
| XLogP | 1.11 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|