C20H28N2O3 — CID 54120675
(3R)-1-[2-[(2-phenylcyclohexylidene)amino]oxyethyl]piperidine-3-carboxylic acid (PubChem CID 54120675) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is (3R)-1-[2-[(2-phenylcyclohexylidene)amino]oxyethyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-[(2-phenylcyclohexylidene)amino]oxyethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 54120675 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (3R)-1-[2-[(2-phenylcyclohexylidene)amino]oxyethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(CCON=C2CCCCC2c2ccccc2)C1 |
| InChI | InChI=1S/C20H28N2O3/c23-20(24)17-9-6-12-22(15-17)13-14-25-21-19-11-5-4-10-18(19)16-7-2-1-3-8-16/h1-3,7-8,17-18H,4-6,9-15H2,(H,23,24)/t17-,18?/m1/s1 |
| InChIKey | NNLZMUYZTKXCPW-QNSVNVJESA-N |
| XLogP | 3.51 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|