C26H32N2O3 — CID 54388268
ethyl (3R)-1-[2-[(2-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethyl]piperidine-3-carboxylate (PubChem CID 54388268) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is ethyl (3R)-1-[2-[(2-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-[(2-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 54388268 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | ethyl (3R)-1-[2-[(2-phenyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]oxyethyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(CCON=C2c3ccccc3CCC2c2ccccc2)C1 |
| InChI | InChI=1S/C26H32N2O3/c1-2-30-26(29)22-12-8-16-28(19-22)17-18-31-27-25-23-13-7-6-11-21(23)14-15-24(25)20-9-4-3-5-10-20/h3-7,9-11,13,22,24H,2,8,12,14-19H2,1H3/t22-,24?/m1/s1 |
| InChIKey | VEUSCKWMXXHWHQ-LETIRJCYSA-N |
| XLogP | 4.41 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|