C20H18N4O2 — CID 15228920
6,8-dimethyl-1,3-diphenyl-5,6-dihydropyrazolo[5,4-e][1,4]diazepine-4,7-dione (PubChem CID 15228920) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 6,8-dimethyl-1,3-diphenyl-5,6-dihydropyrazolo[5,4-e][1,4]diazepine-4,7-dione.
| Compound Name | 6,8-dimethyl-1,3-diphenyl-5,6-dihydropyrazolo[5,4-e][1,4]diazepine-4,7-dione |
|---|---|
| PubChem CID | 15228920 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 6,8-dimethyl-1,3-diphenyl-5,6-dihydropyrazolo[5,4-e][1,4]diazepine-4,7-dione |
| SMILES | CC1NC(=O)c2c(-c3ccccc3)nn(-c3ccccc3)c2N(C)C1=O |
| InChI | InChI=1S/C20H18N4O2/c1-13-20(26)23(2)19-16(18(25)21-13)17(14-9-5-3-6-10-14)22-24(19)15-11-7-4-8-12-15/h3-13H,1-2H3,(H,21,25) |
| InChIKey | RLNFJSLZBUFREM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |