C15H21NO3 — CID 15246410
(E)-3-(oxan-2-yloxy)-N-phenylmethoxypropan-1-imine (PubChem CID 15246410) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (E)-3-(oxan-2-yloxy)-N-phenylmethoxypropan-1-imine.
| Compound Name | (E)-3-(oxan-2-yloxy)-N-phenylmethoxypropan-1-imine |
|---|---|
| PubChem CID | 15246410 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (E)-3-(oxan-2-yloxy)-N-phenylmethoxypropan-1-imine |
| SMILES | C(\CCOC1CCCCO1)=N/OCc1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-2-7-14(8-3-1)13-19-16-10-6-12-18-15-9-4-5-11-17-15/h1-3,7-8,10,15H,4-6,9,11-13H2/b16-10+ |
| InChIKey | CEGODAJHAJWLBH-MHWRWJLKSA-N |
| XLogP | 3.12 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|