C17H18Cl2F2N2 — CID 152511528
3-chloro-5-(4-chlorophenyl)-4-(2,6-difluorohexyl)-6-methylpyridazine (PubChem CID 152511528) has the molecular formula C17H18Cl2F2N2 and a molecular weight of 359.25 g/mol. Its IUPAC name is 3-chloro-5-(4-chlorophenyl)-4-(2,6-difluorohexyl)-6-methylpyridazine.
| Compound Name | 3-chloro-5-(4-chlorophenyl)-4-(2,6-difluorohexyl)-6-methylpyridazine |
|---|---|
| PubChem CID | 152511528 |
| Molecular Formula | C17H18Cl2F2N2 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 3-chloro-5-(4-chlorophenyl)-4-(2,6-difluorohexyl)-6-methylpyridazine |
| SMILES | Cc1nnc(Cl)c(CC(F)CCCCF)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18Cl2F2N2/c1-11-16(12-5-7-13(18)8-6-12)15(17(19)23-22-11)10-14(21)4-2-3-9-20/h5-8,14H,2-4,9-10H2,1H3 |
| InChIKey | YFPNRPQUFMCJMZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|