C26H43FO3 — CID 152520579
2-[(3-tert-butyl-2-methylundecan-2-yl)oxymethyl]-3-(4-fluorophenyl)propanoic acid (PubChem CID 152520579) has the molecular formula C26H43FO3 and a molecular weight of 422.63 g/mol. Its IUPAC name is 2-[(3-tert-butyl-2-methylundecan-2-yl)oxymethyl]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2-[(3-tert-butyl-2-methylundecan-2-yl)oxymethyl]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 152520579 |
| Molecular Formula | C26H43FO3 |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | 2-[(3-tert-butyl-2-methylundecan-2-yl)oxymethyl]-3-(4-fluorophenyl)propanoic acid |
| SMILES | CCCCCCCCC(C(C)(C)C)C(C)(C)OCC(Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C26H43FO3/c1-7-8-9-10-11-12-13-23(25(2,3)4)26(5,6)30-19-21(24(28)29)18-20-14-16-22(27)17-15-20/h14-17,21,23H,7-13,18-19H2,1-6H3,(H,28,29) |
| InChIKey | YHKZIGQYEUHDCS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|