C18H25NO2Si — CID 152530989
tert-butyl 6-(2-trimethylsilylethynyl)-2,3-dihydroindole-1-carboxylate (PubChem CID 152530989) has the molecular formula C18H25NO2Si and a molecular weight of 315.49 g/mol. Its IUPAC name is tert-butyl 6-(2-trimethylsilylethynyl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 6-(2-trimethylsilylethynyl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 152530989 |
| Molecular Formula | C18H25NO2Si |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | tert-butyl 6-(2-trimethylsilylethynyl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(C#C[Si](C)(C)C)cc21 |
| InChI | InChI=1S/C18H25NO2Si/c1-18(2,3)21-17(20)19-11-9-15-8-7-14(13-16(15)19)10-12-22(4,5)6/h7-8,13H,9,11H2,1-6H3 |
| InChIKey | YJNMPUAVHBTWLF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|