C14H26O5 — CID 152537672
2,2,3-trimethoxy-3-(3-prop-1-enoxypropyl)oxane (PubChem CID 152537672) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2,2,3-trimethoxy-3-(3-prop-1-enoxypropyl)oxane.
| Compound Name | 2,2,3-trimethoxy-3-(3-prop-1-enoxypropyl)oxane |
|---|---|
| PubChem CID | 152537672 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2,2,3-trimethoxy-3-(3-prop-1-enoxypropyl)oxane |
| SMILES | CC=COCCCC1(OC)CCCOC1(OC)OC |
| InChI | InChI=1S/C14H26O5/c1-5-10-18-11-6-8-13(15-2)9-7-12-19-14(13,16-3)17-4/h5,10H,6-9,11-12H2,1-4H3 |
| InChIKey | YKWKANMVFXLIEH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|