C8H8N2O3S — CID 152537696
1,1-dioxo-2,3-dihydro-1,3-benzothiazole-2-carboxamide (PubChem CID 152537696) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydro-1,3-benzothiazole-2-carboxamide.
| Compound Name | 1,1-dioxo-2,3-dihydro-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 152537696 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 1,1-dioxo-2,3-dihydro-1,3-benzothiazole-2-carboxamide |
| SMILES | NC(=O)C1Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C8H8N2O3S/c9-7(11)8-10-5-3-1-2-4-6(5)14(8,12)13/h1-4,8,10H,(H2,9,11) |
| InChIKey | YKWNGPPEJMWZAX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |