C9H10N2O3S — CID 151760838
2-methyl-1,1-dioxo-3H-1,3-benzothiazole-2-carboxamide (PubChem CID 151760838) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-methyl-1,1-dioxo-3H-1,3-benzothiazole-2-carboxamide.
| Compound Name | 2-methyl-1,1-dioxo-3H-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 151760838 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-methyl-1,1-dioxo-3H-1,3-benzothiazole-2-carboxamide |
| SMILES | CC1(C(N)=O)Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C9H10N2O3S/c1-9(8(10)12)11-6-4-2-3-5-7(6)15(9,13)14/h2-5,11H,1H3,(H2,10,12) |
| InChIKey | RQNGGXQMMVPHQL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |