C10H12O4S — CID 152548765
1,2-dimethyl-4-sulfanylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 152548765) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is 1,2-dimethyl-4-sulfanylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1,2-dimethyl-4-sulfanylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 152548765 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1,2-dimethyl-4-sulfanylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1C(C(=O)O)=C(S)C=CC1(C)C(=O)O |
| InChI | InChI=1S/C10H12O4S/c1-5-7(8(11)12)6(15)3-4-10(5,2)9(13)14/h3-5,15H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | YNAQBJWJZVQVTA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|