C28H30NO5P — CID 15254887
[5-[(R)-bis(phenylmethoxy)phosphoryl-[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]methanol (PubChem CID 15254887) has the molecular formula C28H30NO5P and a molecular weight of 491.52 g/mol. Its IUPAC name is [5-[(R)-bis(phenylmethoxy)phosphoryl-[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]methanol.
| Compound Name | [5-[(R)-bis(phenylmethoxy)phosphoryl-[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 15254887 |
| Molecular Formula | C28H30NO5P |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | [5-[(R)-bis(phenylmethoxy)phosphoryl-[[(1R)-1-phenylethyl]amino]methyl]furan-2-yl]methanol |
| SMILES | C[C@@H](N[C@@H](c1ccc(CO)o1)P(=O)(OCc1ccccc1)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30NO5P/c1-22(25-15-9-4-10-16-25)29-28(27-18-17-26(19-30)34-27)35(31,32-20-23-11-5-2-6-12-23)33-21-24-13-7-3-8-14-24/h2-18,22,28-30H,19-21H2,1H3/t22-,28-/m1/s1 |
| InChIKey | ZUIMRMQBFJXGJV-SKCUWOTOSA-N |
| XLogP | 6.75 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|