C19H25BrF3NO3 — CID 152559866
butyl 4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxy]-4-methylpiperidine-1-carboxylate (PubChem CID 152559866) has the molecular formula C19H25BrF3NO3 and a molecular weight of 452.31 g/mol. Its IUPAC name is butyl 4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxy]-4-methylpiperidine-1-carboxylate.
| Compound Name | butyl 4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxy]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 152559866 |
| Molecular Formula | C19H25BrF3NO3 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | butyl 4-[[3-bromo-5-(trifluoromethyl)phenyl]methoxy]-4-methylpiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(C)(OCc2cc(Br)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H25BrF3NO3/c1-3-4-9-26-17(25)24-7-5-18(2,6-8-24)27-13-14-10-15(19(21,22)23)12-16(20)11-14/h10-12H,3-9,13H2,1-2H3 |
| InChIKey | YPGMFRCDJOYVLI-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|