C44H46O3 — CID 152561986
1,2,3-tris[2-[(2-methylpropan-2-yl)oxy]phenyl]anthracene (PubChem CID 152561986) has the molecular formula C44H46O3 and a molecular weight of 622.85 g/mol. Its IUPAC name is 1,2,3-tris[2-[(2-methylpropan-2-yl)oxy]phenyl]anthracene.
| Compound Name | 1,2,3-tris[2-[(2-methylpropan-2-yl)oxy]phenyl]anthracene |
|---|---|
| PubChem CID | 152561986 |
| Molecular Formula | C44H46O3 |
| Molecular Weight | 622.85 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | 1,2,3-tris[2-[(2-methylpropan-2-yl)oxy]phenyl]anthracene |
| SMILES | CC(C)(C)Oc1ccccc1-c1cc2cc3ccccc3cc2c(-c2ccccc2OC(C)(C)C)c1-c1ccccc1OC(C)(C)C |
| InChI | InChI=1S/C44H46O3/c1-42(2,3)45-37-23-15-12-20-32(37)36-28-31-26-29-18-10-11-19-30(29)27-35(31)40(33-21-13-16-24-38(33)46-43(4,5)6)41(36)34-22-14-17-25-39(34)47-44(7,8)9/h10-28H,1-9H3 |
| InChIKey | YPRUKVHCZGEBEU-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.85 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|