C56H70 — CID 152631065
1,2,3-tris(3,4-ditert-butylphenyl)anthracene (PubChem CID 152631065) has the molecular formula C56H70 and a molecular weight of 743.18 g/mol. Its IUPAC name is 1,2,3-tris(3,4-ditert-butylphenyl)anthracene.
| Compound Name | 1,2,3-tris(3,4-ditert-butylphenyl)anthracene |
|---|---|
| PubChem CID | 152631065 |
| Molecular Formula | C56H70 |
| Molecular Weight | 743.18 g/mol |
| Exact Mass | 742.55 |
| IUPAC Name | 1,2,3-tris(3,4-ditert-butylphenyl)anthracene |
| SMILES | CC(C)(C)c1ccc(-c2cc3cc4ccccc4cc3c(-c3ccc(C(C)(C)C)c(C(C)(C)C)c3)c2-c2ccc(C(C)(C)C)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C56H70/c1-51(2,3)43-26-23-37(32-46(43)54(10,11)12)41-31-40-29-35-21-19-20-22-36(35)30-42(40)50(39-25-28-45(53(7,8)9)48(34-39)56(16,17)18)49(41)38-24-27-44(52(4,5)6)47(33-38)55(13,14)15/h19-34H,1-18H3 |
| InChIKey | ZDNQEZJLNPXKES-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.18 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|