C20H18O2Se2 — CID 15257774
1,2-dimethoxy-4,5-bis(phenylselanyl)benzene (PubChem CID 15257774) has the molecular formula C20H18O2Se2 and a molecular weight of 448.28 g/mol. Its IUPAC name is 1,2-dimethoxy-4,5-bis(phenylselanyl)benzene.
| Compound Name | 1,2-dimethoxy-4,5-bis(phenylselanyl)benzene |
|---|---|
| PubChem CID | 15257774 |
| Molecular Formula | C20H18O2Se2 |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | 1,2-dimethoxy-4,5-bis(phenylselanyl)benzene |
| SMILES | COc1cc([Se]c2ccccc2)c([Se]c2ccccc2)cc1OC |
| InChI | InChI=1S/C20H18O2Se2/c1-21-17-13-19(23-15-9-5-3-6-10-15)20(14-18(17)22-2)24-16-11-7-4-8-12-16/h3-14H,1-2H3 |
| InChIKey | ILSVNMHWUSGSBJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|