C22H31NO9 — CID 15258037
dimethyl 5,5,6,6-tetraethoxy-4-phenyl-1,4-oxazine-2,3-dicarboxylate (PubChem CID 15258037) has the molecular formula C22H31NO9 and a molecular weight of 453.49 g/mol. Its IUPAC name is dimethyl 5,5,6,6-tetraethoxy-4-phenyl-1,4-oxazine-2,3-dicarboxylate.
| Compound Name | dimethyl 5,5,6,6-tetraethoxy-4-phenyl-1,4-oxazine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 15258037 |
| Molecular Formula | C22H31NO9 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | dimethyl 5,5,6,6-tetraethoxy-4-phenyl-1,4-oxazine-2,3-dicarboxylate |
| SMILES | CCOC1(OCC)OC(C(=O)OC)=C(C(=O)OC)N(c2ccccc2)C1(OCC)OCC |
| InChI | InChI=1S/C22H31NO9/c1-7-28-21(29-8-2)22(30-9-3,31-10-4)32-18(20(25)27-6)17(19(24)26-5)23(21)16-14-12-11-13-15-16/h11-15H,7-10H2,1-6H3 |
| InChIKey | CFODCGPPFCBOOY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|