C33H25F3O4 — CID 152580744
3-[(1S,3R)-3-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]chromene-2,4-dione (PubChem CID 152580744) has the molecular formula C33H25F3O4 and a molecular weight of 542.55 g/mol. Its IUPAC name is 3-[(1S,3R)-3-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]chromene-2,4-dione.
| Compound Name | 3-[(1S,3R)-3-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]chromene-2,4-dione |
|---|---|
| PubChem CID | 152580744 |
| Molecular Formula | C33H25F3O4 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 3-[(1S,3R)-3-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,2,3,4-tetrahydronaphthalen-1-yl]chromene-2,4-dione |
| SMILES | O=C1Oc2ccccc2C(=O)C1[C@@H]1C[C@@H](c2ccc(OCc3ccc(C(F)(F)F)cc3)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C33H25F3O4/c34-33(35,36)24-13-9-20(10-14-24)19-39-25-15-11-21(12-16-25)23-17-22-5-1-2-6-26(22)28(18-23)30-31(37)27-7-3-4-8-29(27)40-32(30)38/h1-16,23,28,30H,17-19H2/t23-,28+,30?/m0/s1 |
| InChIKey | YTKLADSUQQKUCY-WZVJSNPZSA-N |
| XLogP | 7.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|