About 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine
6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine (PubChem CID 152581853) has the molecular formula C24H23F3N2O
and a molecular weight of 412.46 g/mol. Its IUPAC name is 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine.
Molecular Properties
| Compound Name | 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine |
| PubChem CID | 152581853 |
| Molecular Formula | C24H23F3N2O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1ccc(C(F)(F)F)c(Nc3ccccc3)c1C2 |
| InChI | InChI=1S/C24H23F3N2O/c1-3-29(4-2)18-11-10-16-14-19-21(30-22(16)15-18)13-12-20(24(25,26)27)23(19)28-17-8-6-5-7-9-17/h5-13,15,28H,3-4,14H2,1-2H3 |
| InChIKey | YTQLBXMDQKANTR-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine?
The IUPAC name of 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine (CID 152581853) is 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine.
What is the SMILES notation for 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine?
The canonical SMILES for 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine is CCN(CC)c1ccc2c(c1)Oc1ccc(C(F)(F)F)c(Nc3ccccc3)c1C2.
What is the InChIKey of 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine?
The InChIKey is YTQLBXMDQKANTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23F3N2O/c1-3-29(4-2)18-11-10-16-14-19-21(30-22(16)15-18)13-12-20(24(25,26)27)23(19)28-17-8-6-5-7-9-17/h5-13,15,28H,3-4,14H2,1-2H3.
What are the key properties of 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine?
6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine has a molecular weight of 412.46 g/mol, XLogP of 6.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,6-N-diethyl-1-N-phenyl-2-(trifluoromethyl)-9H-xanthene-1,6-diamine is sourced from PubChem (CID 152581853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).