C22H22F4N2 — CID 152585201
2-[4-(4-fluorophenyl)but-3-ynyl]-4-[3-(trifluoromethyl)phenyl]piperidin-1-amine (PubChem CID 152585201) has the molecular formula C22H22F4N2 and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)but-3-ynyl]-4-[3-(trifluoromethyl)phenyl]piperidin-1-amine.
| Compound Name | 2-[4-(4-fluorophenyl)but-3-ynyl]-4-[3-(trifluoromethyl)phenyl]piperidin-1-amine |
|---|---|
| PubChem CID | 152585201 |
| Molecular Formula | C22H22F4N2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[4-(4-fluorophenyl)but-3-ynyl]-4-[3-(trifluoromethyl)phenyl]piperidin-1-amine |
| SMILES | NN1CCC(c2cccc(C(F)(F)F)c2)CC1CCC#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22F4N2/c23-20-10-8-16(9-11-20)4-1-2-7-21-15-18(12-13-28(21)27)17-5-3-6-19(14-17)22(24,25)26/h3,5-6,8-11,14,18,21H,2,7,12-13,15,27H2 |
| InChIKey | YUHRNDVNIASCKD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|