C12H9NO3 — CID 15259310
methyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate (PubChem CID 15259310) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is methyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate.
| Compound Name | methyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 15259310 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | methyl 1H-[1]benzofuro[3,2-b]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc2oc3ccccc3c2[nH]1 |
| InChI | InChI=1S/C12H9NO3/c1-15-12(14)8-6-10-11(13-8)7-4-2-3-5-9(7)16-10/h2-6,13H,1H3 |
| InChIKey | AOWSNWURKKOALC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |