C45H63F12NO — CID 152604508
(2R)-2-[bis[3,5-bis(trifluoromethyl)phenyl]-(5-butyl-14,14-dimethyloctadecan-5-yl)oxymethyl]pyrrolidine (PubChem CID 152604508) has the molecular formula C45H63F12NO and a molecular weight of 861.98 g/mol. Its IUPAC name is (2R)-2-[bis[3,5-bis(trifluoromethyl)phenyl]-(5-butyl-14,14-dimethyloctadecan-5-yl)oxymethyl]pyrrolidine.
| Compound Name | (2R)-2-[bis[3,5-bis(trifluoromethyl)phenyl]-(5-butyl-14,14-dimethyloctadecan-5-yl)oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 152604508 |
| Molecular Formula | C45H63F12NO |
| Molecular Weight | 861.98 g/mol |
| Exact Mass | 861.47 |
| IUPAC Name | (2R)-2-[bis[3,5-bis(trifluoromethyl)phenyl]-(5-butyl-14,14-dimethyloctadecan-5-yl)oxymethyl]pyrrolidine |
| SMILES | CCCCC(C)(C)CCCCCCCCC(CCCC)(CCCC)OC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1CCCN1 |
| InChI | InChI=1S/C45H63F12NO/c1-6-9-20-39(4,5)21-16-14-12-13-15-17-24-40(22-10-7-2,23-11-8-3)59-41(38-19-18-25-58-38,32-26-34(42(46,47)48)30-35(27-32)43(49,50)51)33-28-36(44(52,53)54)31-37(29-33)45(55,56)57/h26-31,38,58H,6-25H2,1-5H3/t38-/m1/s1 |
| InChIKey | YYFMSIDWZOSKOG-KXQOOQHDSA-N |
| XLogP | 16.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.98 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|