C24H31F4NOSi — CID 142685120
[bis[3,5-bis(fluoromethyl)phenyl]-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane (PubChem CID 142685120) has the molecular formula C24H31F4NOSi and a molecular weight of 453.60 g/mol. Its IUPAC name is [bis[3,5-bis(fluoromethyl)phenyl]-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane.
| Compound Name | [bis[3,5-bis(fluoromethyl)phenyl]-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 142685120 |
| Molecular Formula | C24H31F4NOSi |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | [bis[3,5-bis(fluoromethyl)phenyl]-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1cc(CF)cc(CF)c1)(c1cc(CF)cc(CF)c1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C24H31F4NOSi/c1-31(2,3)30-24(23-5-4-6-29-23,21-9-17(13-25)7-18(10-21)14-26)22-11-19(15-27)8-20(12-22)16-28/h7-12,23,29H,4-6,13-16H2,1-3H3/t23-/m0/s1 |
| InChIKey | RGIUACLHLPPTBM-QHCPKHFHSA-N |
| XLogP | 6.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|