C25H36NOSSi2 — CID 136798627
CID 136798627 (PubChem CID 136798627) has the molecular formula C25H36NOSSi2 and a molecular weight of 454.81 g/mol.
| Compound Name | CID 136798627 |
|---|---|
| PubChem CID | 136798627 |
| Molecular Formula | C25H36NOSSi2 |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | — |
| SMILES | C[Si](C)(CCCSCCC[Si])OC(c1ccccc1)(c1ccccc1)[C@H]1CCCN1 |
| InChI | InChI=1S/C25H36NOSSi2/c1-30(2,21-11-19-28-18-10-20-29)27-25(24-16-9-17-26-24,22-12-5-3-6-13-22)23-14-7-4-8-15-23/h3-8,12-15,24,26H,9-11,16-21H2,1-2H3/t24-/m1/s1 |
| InChIKey | SGOXUTLAHKJTCV-XMMPIXPASA-N |
| XLogP | 6.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|