C30H32N4O5S — CID 152636346
(E)-3-[4-[2-[2,6-dimethyl-4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)phenoxy]ethoxymethyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 152636346) has the molecular formula C30H32N4O5S and a molecular weight of 560.68 g/mol. Its IUPAC name is (E)-3-[4-[2-[2,6-dimethyl-4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)phenoxy]ethoxymethyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[2-[2,6-dimethyl-4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)phenoxy]ethoxymethyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 152636346 |
| Molecular Formula | C30H32N4O5S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | (E)-3-[4-[2-[2,6-dimethyl-4-(11-methyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)phenoxy]ethoxymethyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | Cc1cc(-c2nc3sc4c(c3c(=O)[nH]2)CCN(C)C4)cc(C)c1OCCOCc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C30H32N4O5S/c1-18-14-22(28-31-29(36)26-23-10-11-34(3)16-24(23)40-30(26)32-28)15-19(2)27(18)39-13-12-38-17-21-6-4-20(5-7-21)8-9-25(35)33-37/h4-9,14-15,37H,10-13,16-17H2,1-3H3,(H,33,35)(H,31,32,36)/b9-8+ |
| InChIKey | ZEPOIXBVVRUQAI-CMDGGOBGSA-N |
| XLogP | 4.37 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|