C19H18BrN3O4S — CID 162652390
11-acetyl-5-(3-bromo-4,5-dimethoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 162652390) has the molecular formula C19H18BrN3O4S and a molecular weight of 464.34 g/mol. Its IUPAC name is 11-acetyl-5-(3-bromo-4,5-dimethoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-acetyl-5-(3-bromo-4,5-dimethoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 162652390 |
| Molecular Formula | C19H18BrN3O4S |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 11-acetyl-5-(3-bromo-4,5-dimethoxyphenyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | COc1cc(-c2nc3sc4c(c3c(=O)[nH]2)CCN(C(C)=O)C4)cc(Br)c1OC |
| InChI | InChI=1S/C19H18BrN3O4S/c1-9(24)23-5-4-11-14(8-23)28-19-15(11)18(25)21-17(22-19)10-6-12(20)16(27-3)13(7-10)26-2/h6-7H,4-5,8H2,1-3H3,(H,21,22,25) |
| InChIKey | QWPDPTUHQLEUJP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |