C22H20N4O5S — CID 46899698
ethyl 5-(2-imino-8-methoxychromen-3-yl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate (PubChem CID 46899698) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is ethyl 5-(2-imino-8-methoxychromen-3-yl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate.
| Compound Name | ethyl 5-(2-imino-8-methoxychromen-3-yl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
|---|---|
| PubChem CID | 46899698 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | ethyl 5-(2-imino-8-methoxychromen-3-yl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
| SMILES | [H]/N=c1\oc2c(OC)cccc2cc1-c1nc2sc3c(c2c(=O)[nH]1)CCN(C(=O)OCC)C3 |
| InChI | InChI=1S/C22H20N4O5S/c1-3-30-22(28)26-8-7-12-15(10-26)32-21-16(12)20(27)24-19(25-21)13-9-11-5-4-6-14(29-2)17(11)31-18(13)23/h4-6,9,23H,3,7-8,10H2,1-2H3,(H,24,25,27)/b23-18- |
| InChIKey | FHHLUVBZOBAMAM-NKFKGCMQSA-N |
| XLogP | 3.40 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |