C14H15N3O3S2 — CID 86209105
ethyl 16-oxo-8,12-dithia-5,10,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-triene-5-carboxylate (PubChem CID 86209105) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is ethyl 16-oxo-8,12-dithia-5,10,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-triene-5-carboxylate.
| Compound Name | ethyl 16-oxo-8,12-dithia-5,10,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-triene-5-carboxylate |
|---|---|
| PubChem CID | 86209105 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | ethyl 16-oxo-8,12-dithia-5,10,15-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),10-triene-5-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3nc4n(c(=O)c23)CCS4)C1 |
| InChI | InChI=1S/C14H15N3O3S2/c1-2-20-14(19)16-4-3-8-9(7-16)22-11-10(8)12(18)17-5-6-21-13(17)15-11/h2-7H2,1H3 |
| InChIKey | NBGBYDPPNVBBKK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |