C20H25N3O6S3 — CID 3529467
ethyl 3,5-bis[(2-ethoxy-2-oxoethyl)sulfanyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate (PubChem CID 3529467) has the molecular formula C20H25N3O6S3 and a molecular weight of 499.64 g/mol. Its IUPAC name is ethyl 3,5-bis[(2-ethoxy-2-oxoethyl)sulfanyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate.
| Compound Name | ethyl 3,5-bis[(2-ethoxy-2-oxoethyl)sulfanyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 3529467 |
| Molecular Formula | C20H25N3O6S3 |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | ethyl 3,5-bis[(2-ethoxy-2-oxoethyl)sulfanyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
| SMILES | CCOC(=O)CSc1nc(SCC(=O)OCC)c2c3c(sc2n1)CN(C(=O)OCC)CC3 |
| InChI | InChI=1S/C20H25N3O6S3/c1-4-27-14(24)10-30-17-16-12-7-8-23(20(26)29-6-3)9-13(12)32-18(16)22-19(21-17)31-11-15(25)28-5-2/h4-11H2,1-3H3 |
| InChIKey | BCXKLHKGTAYNPT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|