C20H18N4O3S2 — CID 990381
ethyl 9-oxo-6-phenyl-4,17-dithia-2,7,8,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,11(16)-tetraene-14-carboxylate (PubChem CID 990381) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is ethyl 9-oxo-6-phenyl-4,17-dithia-2,7,8,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,11(16)-tetraene-14-carboxylate.
| Compound Name | ethyl 9-oxo-6-phenyl-4,17-dithia-2,7,8,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,11(16)-tetraene-14-carboxylate |
|---|---|
| PubChem CID | 990381 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 9-oxo-6-phenyl-4,17-dithia-2,7,8,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,6,11(16)-tetraene-14-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3nc4n(c(=O)c23)N=C(c2ccccc2)CS4)C1 |
| InChI | InChI=1S/C20H18N4O3S2/c1-2-27-20(26)23-9-8-13-15(10-23)29-17-16(13)18(25)24-19(21-17)28-11-14(22-24)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3 |
| InChIKey | CPELRHBPFWDXHZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |