C17H16N4O3S — CID 15512585
ethyl 3-oxo-5-pyridin-3-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate (PubChem CID 15512585) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is ethyl 3-oxo-5-pyridin-3-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate.
| Compound Name | ethyl 3-oxo-5-pyridin-3-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
|---|---|
| PubChem CID | 15512585 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | ethyl 3-oxo-5-pyridin-3-yl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-triene-11-carboxylate |
| SMILES | CCOC(=O)N1CCc2c(sc3nc(-c4cccnc4)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C17H16N4O3S/c1-2-24-17(23)21-7-5-11-12(9-21)25-16-13(11)15(22)19-14(20-16)10-4-3-6-18-8-10/h3-4,6,8H,2,5,7,9H2,1H3,(H,19,20,22) |
| InChIKey | WGRDGASYKDNPFW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |