C20H16N4O3S — CID 46899696
11-acetyl-5-(2-iminochromen-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 46899696) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 11-acetyl-5-(2-iminochromen-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-acetyl-5-(2-iminochromen-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 46899696 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 11-acetyl-5-(2-iminochromen-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | [H]/N=c1\oc2ccccc2cc1-c1nc2sc3c(c2c(=O)[nH]1)CCN(C(C)=O)C3 |
| InChI | InChI=1S/C20H16N4O3S/c1-10(25)24-7-6-12-15(9-24)28-20-16(12)19(26)22-18(23-20)13-8-11-4-2-3-5-14(11)27-17(13)21/h2-5,8,21H,6-7,9H2,1H3,(H,22,23,26)/b21-17- |
| InChIKey | BBCVUVGQHGASOZ-FXBPSFAMSA-N |
| XLogP | 2.78 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |