C21H19F2NO4S — CID 152637818
2-(2,4-difluorophenyl)-6-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]inden-1-one (PubChem CID 152637818) has the molecular formula C21H19F2NO4S and a molecular weight of 419.45 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-6-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]inden-1-one.
| Compound Name | 2-(2,4-difluorophenyl)-6-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]inden-1-one |
|---|---|
| PubChem CID | 152637818 |
| Molecular Formula | C21H19F2NO4S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)-6-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethoxy]inden-1-one |
| SMILES | O=C1C(c2ccc(F)cc2F)=Cc2ccc(OCCN3CCS(=O)(=O)CC3)cc21 |
| InChI | InChI=1S/C21H19F2NO4S/c22-15-2-4-17(20(23)12-15)19-11-14-1-3-16(13-18(14)21(19)25)28-8-5-24-6-9-29(26,27)10-7-24/h1-4,11-13H,5-10H2 |
| InChIKey | ZEXFTYDWXUBRDG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|