C13H10ClF3N2O — CID 152668229
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-methyl-2H-pyridine-4-carbaldehyde (PubChem CID 152668229) has the molecular formula C13H10ClF3N2O and a molecular weight of 302.68 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-methyl-2H-pyridine-4-carbaldehyde.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-methyl-2H-pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 152668229 |
| Molecular Formula | C13H10ClF3N2O |
| Molecular Weight | 302.68 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-3-methyl-2H-pyridine-4-carbaldehyde |
| SMILES | CC1=C(C=O)C=CN(c2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C13H10ClF3N2O/c1-8-6-19(3-2-9(8)7-20)12-11(14)4-10(5-18-12)13(15,16)17/h2-5,7H,6H2,1H3 |
| InChIKey | ZKYUPRPQSZRPAH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|