C10H18O — CID 15267831
(4E)-3,7-dimethylocta-4,6-dien-1-ol (PubChem CID 15267831) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (4E)-3,7-dimethylocta-4,6-dien-1-ol.
| Compound Name | (4E)-3,7-dimethylocta-4,6-dien-1-ol |
|---|---|
| PubChem CID | 15267831 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (4E)-3,7-dimethylocta-4,6-dien-1-ol |
| SMILES | CC(C)=C/C=C/C(C)CCO |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h4-6,10-11H,7-8H2,1-3H3/b6-4+ |
| InChIKey | CXHLZAFYZWLCIN-GQCTYLIASA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|