C10H10N2O3 — CID 152705884
ethyl 7-hydroxypyrrolo[2,3-b]pyridine-4-carboxylate (PubChem CID 152705884) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is ethyl 7-hydroxypyrrolo[2,3-b]pyridine-4-carboxylate.
| Compound Name | ethyl 7-hydroxypyrrolo[2,3-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 152705884 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | ethyl 7-hydroxypyrrolo[2,3-b]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccn(O)c2nccc1-2 |
| InChI | InChI=1S/C10H10N2O3/c1-2-15-10(13)8-4-6-12(14)9-7(8)3-5-11-9/h3-6,14H,2H2,1H3 |
| InChIKey | FIFWGJDKIDXMGP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|