C15H23BN2O — CID 152706902
CID 152706902 (PubChem CID 152706902) has the molecular formula C15H23BN2O and a molecular weight of 258.17 g/mol.
| Compound Name | CID 152706902 |
|---|---|
| PubChem CID | 152706902 |
| Molecular Formula | C15H23BN2O |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CN2C[C@@H](C)N(CCO)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C15H23BN2O/c1-12-9-17(10-13(2)18(12)7-8-19)11-14-3-5-15(16)6-4-14/h3-6,12-13,19H,7-11H2,1-2H3/t12-,13+ |
| InChIKey | ZSTOFTDGKXLGAG-BETUJISGSA-N |
| XLogP | 0.37 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|