C14H23N3O5 — CID 152742112
methyl (E,4S)-4-[[(2R)-4-amino-2-(butanoylamino)-4-oxobutanoyl]amino]pent-2-enoate (PubChem CID 152742112) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is methyl (E,4S)-4-[[(2R)-4-amino-2-(butanoylamino)-4-oxobutanoyl]amino]pent-2-enoate.
| Compound Name | methyl (E,4S)-4-[[(2R)-4-amino-2-(butanoylamino)-4-oxobutanoyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 152742112 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | methyl (E,4S)-4-[[(2R)-4-amino-2-(butanoylamino)-4-oxobutanoyl]amino]pent-2-enoate |
| SMILES | CCCC(=O)N[C@H](CC(N)=O)C(=O)N[C@@H](C)/C=C/C(=O)OC |
| InChI | InChI=1S/C14H23N3O5/c1-4-5-12(19)17-10(8-11(15)18)14(21)16-9(2)6-7-13(20)22-3/h6-7,9-10H,4-5,8H2,1-3H3,(H2,15,18)(H,16,21)(H,17,19)/b7-6+/t9-,10+/m0/s1 |
| InChIKey | ZZVCGADJLIAQPE-LOSXEJPUSA-N |
| XLogP | -0.62 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|