C22H21F2N3O3 — CID 152742849
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(4-methylpent-2-ynyl)-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 152742849) has the molecular formula C22H21F2N3O3 and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(4-methylpent-2-ynyl)-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(4-methylpent-2-ynyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 152742849 |
| Molecular Formula | C22H21F2N3O3 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-1-(4-methylpent-2-ynyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CC(C)C#CCn1c(-c2ccc(OC(F)F)c(OC3CC3)c2)cc2c(=O)[nH]ncc21 |
| InChI | InChI=1S/C22H21F2N3O3/c1-13(2)4-3-9-27-17(11-16-18(27)12-25-26-21(16)28)14-5-8-19(30-22(23)24)20(10-14)29-15-6-7-15/h5,8,10-13,15,22H,6-7,9H2,1-2H3,(H,26,28) |
| InChIKey | ZZYYAEHRCCZWOQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|