C22H26F2IN3O4Si — CID 66602914
2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-iodo-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 66602914) has the molecular formula C22H26F2IN3O4Si and a molecular weight of 589.45 g/mol. Its IUPAC name is 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-iodo-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-iodo-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 66602914 |
| Molecular Formula | C22H26F2IN3O4Si |
| Molecular Weight | 589.45 g/mol |
| Exact Mass | 589.07 |
| IUPAC Name | 2-[3-cyclopropyloxy-4-(difluoromethoxy)phenyl]-3-iodo-1-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(OC(F)F)c(OC3CC3)c2)c(I)c2c(=O)[nH]ncc21 |
| InChI | InChI=1S/C22H26F2IN3O4Si/c1-33(2,3)9-8-30-12-28-15-11-26-27-21(29)18(15)19(25)20(28)13-4-7-16(32-22(23)24)17(10-13)31-14-5-6-14/h4,7,10-11,14,22H,5-6,8-9,12H2,1-3H3,(H,27,29) |
| InChIKey | NFWUJAGLBPQKIX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|