C21H24F3NO2Si — CID 175349192
2-[[5-[2-(difluoromethoxy)-6-fluorophenyl]indol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 175349192) has the molecular formula C21H24F3NO2Si and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[[5-[2-(difluoromethoxy)-6-fluorophenyl]indol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[2-(difluoromethoxy)-6-fluorophenyl]indol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175349192 |
| Molecular Formula | C21H24F3NO2Si |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[[5-[2-(difluoromethoxy)-6-fluorophenyl]indol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ccc2cc(-c3c(F)cccc3OC(F)F)ccc21 |
| InChI | InChI=1S/C21H24F3NO2Si/c1-28(2,3)12-11-26-14-25-10-9-15-13-16(7-8-18(15)25)20-17(22)5-4-6-19(20)27-21(23)24/h4-10,13,21H,11-12,14H2,1-3H3 |
| InChIKey | OAKWKRKTMLQCFU-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|