C20H30ClNO4Si — CID 22485693
3-chloro-2-propoxy-3-[1-(2-trimethylsilylethoxymethyl)indol-5-yl]propanoic acid (PubChem CID 22485693) has the molecular formula C20H30ClNO4Si and a molecular weight of 412.00 g/mol. Its IUPAC name is 3-chloro-2-propoxy-3-[1-(2-trimethylsilylethoxymethyl)indol-5-yl]propanoic acid.
| Compound Name | 3-chloro-2-propoxy-3-[1-(2-trimethylsilylethoxymethyl)indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 22485693 |
| Molecular Formula | C20H30ClNO4Si |
| Molecular Weight | 412.00 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-chloro-2-propoxy-3-[1-(2-trimethylsilylethoxymethyl)indol-5-yl]propanoic acid |
| SMILES | CCCOC(C(=O)O)C(Cl)c1ccc2c(ccn2COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C20H30ClNO4Si/c1-5-10-26-19(20(23)24)18(21)16-6-7-17-15(13-16)8-9-22(17)14-25-11-12-27(2,3)4/h6-9,13,18-19H,5,10-12,14H2,1-4H3,(H,23,24) |
| InChIKey | YXKSRUAQFSLNFX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.00 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|