C11H14N2 — CID 152743255
1-(3aH-indol-3-yl)-N,N-dimethylmethanamine (PubChem CID 152743255) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-(3aH-indol-3-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(3aH-indol-3-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 152743255 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-(3aH-indol-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1=CN=C2C=CC=CC12 |
| InChI | InChI=1S/C11H14N2/c1-13(2)8-9-7-12-11-6-4-3-5-10(9)11/h3-7,10H,8H2,1-2H3 |
| InChIKey | OPCOBBCNFGIOHW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |