C15H22N2 — CID 152743315
N,N-diethyl-2-(2-methyl-3aH-indol-3-yl)ethanamine (PubChem CID 152743315) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N,N-diethyl-2-(2-methyl-3aH-indol-3-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(2-methyl-3aH-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 152743315 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N,N-diethyl-2-(2-methyl-3aH-indol-3-yl)ethanamine |
| SMILES | CCN(CC)CCC1=C(C)N=C2C=CC=CC21 |
| InChI | InChI=1S/C15H22N2/c1-4-17(5-2)11-10-13-12(3)16-15-9-7-6-8-14(13)15/h6-9,14H,4-5,10-11H2,1-3H3 |
| InChIKey | GQQLQQJRWFSUFA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |