C19H14Cl2N2O — CID 152744474
CID 152744474 (PubChem CID 152744474) has the molecular formula C19H14Cl2N2O and a molecular weight of 357.24 g/mol.
| Compound Name | CID 152744474 |
|---|---|
| PubChem CID | 152744474 |
| Molecular Formula | C19H14Cl2N2O |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | — |
| SMILES | CC(=C=Cn1ccnc1)c1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O/c1-14(8-10-23-11-9-22-13-23)15-2-5-17(6-3-15)24-19-7-4-16(20)12-18(19)21/h2-7,9-13H,1H3 |
| InChIKey | OYLRDFFBZLFOKO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |