C17H14Cl2O2S2 — CID 2806224
1-[4-(2,4-dichlorophenoxy)phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one (PubChem CID 2806224) has the molecular formula C17H14Cl2O2S2 and a molecular weight of 385.34 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorophenoxy)phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one.
| Compound Name | 1-[4-(2,4-dichlorophenoxy)phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2806224 |
| Molecular Formula | C17H14Cl2O2S2 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 1-[4-(2,4-dichlorophenoxy)phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one |
| SMILES | CSC(=CC(=O)c1ccc(Oc2ccc(Cl)cc2Cl)cc1)SC |
| InChI | InChI=1S/C17H14Cl2O2S2/c1-22-17(23-2)10-15(20)11-3-6-13(7-4-11)21-16-8-5-12(18)9-14(16)19/h3-10H,1-2H3 |
| InChIKey | JVIXFHUPPDLVRL-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|